CAS 453582-84-8 is the registry number for 5-(Thiophene-2-sulfonamido)pentanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(thiophen-2-ylsulfonylamino)pentanoic acid (CAS 453582-84-8) is a chemical compound with the molecular formula C9H13NO4S2 and a molecular weight of 263.3 g/mol. IUPAC name: 5-(thiophen-2-ylsulfonylamino)pentanoic acid. InChIKey: IMGSGFZKBRSGOQ-UHFFFAOYSA-N.
| Molecular formula | C9H13NO4S2 |
|---|---|
| Molecular weight | 263.3 g/mol |
| IUPAC name | 5-(thiophen-2-ylsulfonylamino)pentanoic acid |
| InChIKey | IMGSGFZKBRSGOQ-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)S(=O)(=O)NCCCCC(=O)O |
Computed by PubChem (NCBI)