CAS 1668584-26-6 appears in our catalog under these names: 8-Methoxyquinoline-6-carboxylic acid, 8-Methoxyquinoline-6-carboxylic acid 98%, 8-Methoxyquinoline-6-carboxylic acid, 98%, 8-Methoxyquinoline-6-carboxylic acid, 98%, 98%. Offered by: Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 50mg, 0,5g, 5g, 100mg, 250mg, 1g.
8-methoxyquinoline-6-carboxylic acid (CAS 1668584-26-6) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 8-methoxyquinoline-6-carboxylic acid. InChIKey: WVIQWFCZZRBQMI-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 8-methoxyquinoline-6-carboxylic acid |
| InChIKey | WVIQWFCZZRBQMI-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC(=C1)C(=O)O)C=CC=N2 |
Computed by PubChem (NCBI)