CAS 1669422-54-1 is the registry number for (E)-1-(benzylideneamino)indoline-2,3-dione. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(E)-benzylideneamino]indole-2,3-dione (CAS 1669422-54-1) is a chemical compound with the molecular formula C15H10N2O2 and a molecular weight of 250.25 g/mol. IUPAC name: 1-[(E)-benzylideneamino]indole-2,3-dione. InChIKey: DVZBWPYYJMHVSV-MHWRWJLKSA-N.
| Molecular formula | C15H10N2O2 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 1-[(E)-benzylideneamino]indole-2,3-dione |
| InChIKey | DVZBWPYYJMHVSV-MHWRWJLKSA-N |
| SMILES | C1=CC=C(C=C1)/C=N/N2C3=CC=CC=C3C(=O)C2=O |
Computed by PubChem (NCBI)