CAS 16728-01-1 appears in our catalog under these names: 1–(4–Methoxyphenyl)–1–cyclopropanecarboxylic Acid, 1-(4-Methoxyphenyl)-1-cyclopropanecarboxylic Acid, >98.0%(GC)(T), 1-(4-Methoxyphenyl)cyclopropanecarboxylic acid, 97%, 1-(4-Methoxyphenyl)cyclopropanecarboxylic acid, 97%, 97%. Offered by: GLPBio, TCI, Fluorochem, Ambeed, Chemat. Available pack sizes: 25g, 5g, 10g, 100g, 250mg, 1g.
1-(4-methoxyphenyl)cyclopropane-1-carboxylic acid (CAS 16728-01-1) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 1-(4-methoxyphenyl)cyclopropane-1-carboxylic acid. InChIKey: WCPFQQHADRJANG-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | WCPFQQHADRJANG-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2(CC2)C(=O)O |
Computed by PubChem (NCBI)