Products 16735-26-5
CAS 16735-26-5 appears in our catalog under these names: N–Benzylmethcathinone (hydrochloride), N-Benzyl MC (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1mg, 5 mg, 1 mg.
2-[benzyl(methyl)amino]-1-phenylpropan-1-one;hydrochloride (CAS 16735-26-5) is a chemical compound with the molecular formula C17H20ClNO and a molecular weight of 289.8 g/mol. IUPAC name: 2-[benzyl(methyl)amino]-1-phenylpropan-1-one;hydrochloride. InChIKey: XKSYQJIHUYNNRT-UHFFFAOYSA-N.
| Molecular formula | C17H20ClNO |
|---|---|
| Molecular weight | 289.8 g/mol |
| IUPAC name | 2-[benzyl(methyl)amino]-1-phenylpropan-1-one;hydrochloride |
| InChIKey | XKSYQJIHUYNNRT-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=CC=C1)N(C)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)