CAS 1674334-75-8 is the registry number for 4-Bromo-11,11-dimethyl-11H-benzo[b]fluorene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4-bromo-11,11-dimethylbenzo[b]fluorene (CAS 1674334-75-8) is a chemical compound with the molecular formula C19H15Br and a molecular weight of 323.2 g/mol. IUPAC name: 4-bromo-11,11-dimethylbenzo[b]fluorene. InChIKey: JEQLJSYNSXAMRQ-UHFFFAOYSA-N.
| Molecular formula | C19H15Br |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | 4-bromo-11,11-dimethylbenzo[b]fluorene |
| InChIKey | JEQLJSYNSXAMRQ-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C(=CC=C2)Br)C3=CC4=CC=CC=C4C=C31)C |
Computed by PubChem (NCBI)