Products 1674334-75-8

CAS 1674334-75-8 is the registry number for 4-Bromo-11,11-dimethyl-11H-benzo[b]fluorene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

4-bromo-11,11-dimethylbenzo[b]fluorene (CAS 1674334-75-8) is a chemical compound with the molecular formula C19H15Br and a molecular weight of 323.2 g/mol. IUPAC name: 4-bromo-11,11-dimethylbenzo[b]fluorene. InChIKey: JEQLJSYNSXAMRQ-UHFFFAOYSA-N.

Identity
Molecular formulaC19H15Br
Molecular weight323.2 g/mol
IUPAC name4-bromo-11,11-dimethylbenzo[b]fluorene
InChIKeyJEQLJSYNSXAMRQ-UHFFFAOYSA-N
SMILESCC1(C2=C(C(=CC=C2)Br)C3=CC4=CC=CC=C4C=C31)C

Computed by PubChem (NCBI)