Products 78540-64-4
CAS 78540-64-4 is the registry number for 4-(Bromomethyl)-1,1':4',1''-terphenyl, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(bromomethyl)-4-(4-phenylphenyl)benzene (CAS 78540-64-4) is a chemical compound with the molecular formula C19H15Br and a molecular weight of 323.2 g/mol. IUPAC name: 1-(bromomethyl)-4-(4-phenylphenyl)benzene. InChIKey: MTRWNZSLLYKTLP-UHFFFAOYSA-N.
| Molecular formula | C19H15Br |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | 1-(bromomethyl)-4-(4-phenylphenyl)benzene |
| InChIKey | MTRWNZSLLYKTLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)CBr |
Computed by PubChem (NCBI)