CAS 954137-48-5 appears in our catalog under these names: 5–Bromo–7,7–dimethyl–7H–benzo(c)fluorene, 5-Bromo-7,7-dimethyl-7H-benzo[c]fluorene, 97%, 97%, 5-Bromo-7,7-dimethyl-7H-benzo[c]fluorene, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g.
5-bromo-7,7-dimethylbenzo[c]fluorene (CAS 954137-48-5) is a chemical compound with the molecular formula C19H15Br and a molecular weight of 323.2 g/mol. IUPAC name: 5-bromo-7,7-dimethylbenzo[c]fluorene. InChIKey: KCHRZPPNAWBDQZ-UHFFFAOYSA-N.
| Molecular formula | C19H15Br |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | 5-bromo-7,7-dimethylbenzo[c]fluorene |
| InChIKey | KCHRZPPNAWBDQZ-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C4=CC=CC=C43)Br)C |
Computed by PubChem (NCBI)