CAS 2124211-83-0 is the registry number for 5-Bromo-11,11-dimethyl-11H-Benzo[b]fluorene, 99.5+%, 99.5+%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 25g, 100g.
5-bromo-11,11-dimethylbenzo[b]fluorene (CAS 2124211-83-0) is a chemical compound with the molecular formula C19H15Br and a molecular weight of 323.2 g/mol. IUPAC name: 5-bromo-11,11-dimethylbenzo[b]fluorene. InChIKey: BCKPKNISWIGCJG-UHFFFAOYSA-N.
| Molecular formula | C19H15Br |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | 5-bromo-11,11-dimethylbenzo[b]fluorene |
| InChIKey | BCKPKNISWIGCJG-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C(C4=CC=CC=C4C=C31)Br)C |
Computed by PubChem (NCBI)