Products 1674359-82-0
CAS 1674359-82-0 appears in our catalog under these names: Sophoracarpan A, Sophoracarpan A. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1 mg, 5 mg.
(6S,6aS,11aR)-6,9-dimethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-ol (CAS 1674359-82-0) is a chemical compound with the molecular formula C17H16O5 and a molecular weight of 300.30 g/mol. IUPAC name: (6S,6aS,11aR)-6,9-dimethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-ol. InChIKey: VDHFFCPQILOKFG-ULQDDVLXSA-N.
| Molecular formula | C17H16O5 |
|---|---|
| Molecular weight | 300.30 g/mol |
| IUPAC name | (6S,6aS,11aR)-6,9-dimethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-ol |
| InChIKey | VDHFFCPQILOKFG-ULQDDVLXSA-N |
| SMILES | CO[C@@H]1[C@@H]2[C@H](C3=C(O1)C=C(C=C3)O)OC4=C2C=CC(=C4)OC |
Computed by PubChem (NCBI)