CAS 1677706-17-0 is the registry number for 5-((Trifluoromethyl)thio)- 1,3-benzodioxole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g.
5-(trifluoromethylsulfanyl)-1,3-benzodioxole (CAS 1677706-17-0) is a chemical compound with the molecular formula C8H5F3O2S and a molecular weight of 222.19 g/mol. IUPAC name: 5-(trifluoromethylsulfanyl)-1,3-benzodioxole. InChIKey: ARZXKUVIIYOXIZ-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2S |
|---|---|
| Molecular weight | 222.19 g/mol |
| IUPAC name | 5-(trifluoromethylsulfanyl)-1,3-benzodioxole |
| InChIKey | ARZXKUVIIYOXIZ-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)SC(F)(F)F |
Computed by PubChem (NCBI)