CAS 946-65-6 appears in our catalog under these names: 3-(Trifluoromethylthio)benzoic acid, 98%, 3-(Trifluoromethylthio)benzoic acid, 97% , 3-((Trifluoromethyl)thio)benzoic acid 98%, 3-((Trifluoromethyl)thio)benzoic acid, 98%, 98%, 3-(Trifluoromethylthio)benzoic acid, 97%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 1g, 250mg, 10g, 100mg.
3-(trifluoromethylsulfanyl)benzoic acid (CAS 946-65-6) is a chemical compound with the molecular formula C8H5F3O2S and a molecular weight of 222.19 g/mol. IUPAC name: 3-(trifluoromethylsulfanyl)benzoic acid. InChIKey: IVGAPIVNQABETQ-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2S |
|---|---|
| Molecular weight | 222.19 g/mol |
| IUPAC name | 3-(trifluoromethylsulfanyl)benzoic acid |
| InChIKey | IVGAPIVNQABETQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)SC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)