Products 28174-98-3

CAS 28174-98-3 is the registry number for 2-Mercapto-4-(trifluoromethyl)benzoic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-sulfanyl-4-(trifluoromethyl)benzoic acid (CAS 28174-98-3) is a chemical compound with the molecular formula C8H5F3O2S and a molecular weight of 222.19 g/mol. IUPAC name: 2-sulfanyl-4-(trifluoromethyl)benzoic acid. InChIKey: IJEWNEIKCNXQQN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5F3O2S
Molecular weight222.19 g/mol
IUPAC name2-sulfanyl-4-(trifluoromethyl)benzoic acid
InChIKeyIJEWNEIKCNXQQN-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(F)(F)F)S)C(=O)O

Computed by PubChem (NCBI)