Products 37526-67-3
CAS 37526-67-3 appears in our catalog under these names: 2-(Trifluoromethylthio)benzoic acid, 97%, 2-((Trifluoromethyl)thio)benzoic acid, 97%, 2-((Trifluoromethyl)thio)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 25g, 1g, 5g, 250mg.
2-(trifluoromethylsulfanyl)benzoic acid (CAS 37526-67-3) is a chemical compound with the molecular formula C8H5F3O2S and a molecular weight of 222.19 g/mol. IUPAC name: 2-(trifluoromethylsulfanyl)benzoic acid. InChIKey: KYCFVGRNHSGPBJ-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2S |
|---|---|
| Molecular weight | 222.19 g/mol |
| IUPAC name | 2-(trifluoromethylsulfanyl)benzoic acid |
| InChIKey | KYCFVGRNHSGPBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)SC(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
2-((Trifluoromethyl)thio)benzoic acid, 2-[(trifluoromethyl)thio]benzoic acid, 2-[(trifluoromethyl)sulfanyl]benzoic acid, 2-((trifluoromethyl)sulfanyl)benzoic acid, 2-(trifluoromethylthio)benzoic acid, 2-(trifluoromethylsulfanyl)benzoic Acid, o-(trifluoromethylthio)benzoic acid, 2-((Trifluoromethyl)thio)benzoicacid