CAS 77611-51-9 is the registry number for 4,4,4-Trifluoro-1-(3-thienyl)-1,3-butanedione, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4,4,4-trifluoro-1-thiophen-3-ylbutane-1,3-dione (CAS 77611-51-9) is a chemical compound with the molecular formula C8H5F3O2S and a molecular weight of 222.19 g/mol. IUPAC name: 4,4,4-trifluoro-1-thiophen-3-ylbutane-1,3-dione. InChIKey: FATXXSNVTXITLM-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2S |
|---|---|
| Molecular weight | 222.19 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-thiophen-3-ylbutane-1,3-dione |
| InChIKey | FATXXSNVTXITLM-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)