CAS 167887-03-8 is the registry number for CC-1069. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(3,4-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide (CAS 167887-03-8) is a chemical compound with the molecular formula C19H18N2O5 and a molecular weight of 354.4 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide. InChIKey: GKPXSGPDRIUIAD-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O5 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide |
| InChIKey | GKPXSGPDRIUIAD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(CC(=O)N)N2C(=O)C3=CC=CC=C3C2=O)OC |
Computed by PubChem (NCBI)