Products 167933-78-0
CAS 167933-78-0 is the registry number for SufS-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R)-3-ethoxycarbonylaziridine-2-carboxylic acid (CAS 167933-78-0) is a chemical compound with the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. IUPAC name: (2R,3R)-3-ethoxycarbonylaziridine-2-carboxylic acid. InChIKey: DIDDEKQOGOEWTH-QWWZWVQMSA-N.
| Molecular formula | C6H9NO4 |
|---|---|
| Molecular weight | 159.14 g/mol |
| IUPAC name | (2R,3R)-3-ethoxycarbonylaziridine-2-carboxylic acid |
| InChIKey | DIDDEKQOGOEWTH-QWWZWVQMSA-N |
| SMILES | CCOC(=O)[C@H]1[C@@H](N1)C(=O)O |
Computed by PubChem (NCBI)