CAS 168130-82-3 appears in our catalog under these names: 1-(Benzo(d)(1,3)dioxol-5-yl)-2,2,2-trifluoroethanol, 95+%, 1-(Benzo[d][1,3]dioxol-5-yl)-2,2,2-trifluoroethanol, 97%, 97%, 1-(Benzo[d][1,3]dioxol-5-yl)-2,2,2-trifluoroethan-1-ol, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 50mg, 100mg, 250mg, 500mg.
1-(1,3-benzodioxol-5-yl)-2,2,2-trifluoroethanol (CAS 168130-82-3) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2,2,2-trifluoroethanol. InChIKey: XSZZPMBWFISURW-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2,2,2-trifluoroethanol |
| InChIKey | XSZZPMBWFISURW-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C(C(F)(F)F)O |
Computed by PubChem (NCBI)