CAS 168162-30-9 appears in our catalog under these names: 3-(N-Boc-n-methylamino)benzoic acid, 95%, 3-{((tert-butoxy)carbonyl)(methyl)amino}benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 10g.
3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoic acid (CAS 168162-30-9) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: 3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoic acid. InChIKey: WKBGXDWFIPYTBR-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoic acid |
| InChIKey | WKBGXDWFIPYTBR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=CC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)