Products 16817-24-6
CAS 16817-24-6 appears in our catalog under these names: 3,7-Dimethyl-1-benzofuran-2-carboxylic acid, 95%, 3,7-Dimethylbenzofuran-2-carboxylic acid, 97%, 3,7-Dimethyl-1-benzofuran-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 2,5g.
3,7-dimethyl-1-benzofuran-2-carboxylic acid (CAS 16817-24-6) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 3,7-dimethyl-1-benzofuran-2-carboxylic acid. InChIKey: KUEJSYJMMRPGTH-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 3,7-dimethyl-1-benzofuran-2-carboxylic acid |
| InChIKey | KUEJSYJMMRPGTH-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=C(O2)C(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
3,7-dimethyl-1-benzofuran-2-carboxylic acid, 3,7-Dimethyl-benzofuran-2-carboxylic acid, 3,7-dimethylbenzofuran-2-carboxylic acid, 3,7-dimethylbenzofuran-2-carboxylicacid, 3,7-Dimethyl-2-benzofurancarboxylic acid, 3,7-dimethylbenzo[b]furan-2-carboxylic acid, 3,7-dimethyl-1-benzofuran-2-carboxylic acid, AldrichCPR