CAS 1687855-96-4 is the registry number for tert-Butyl 7-bromo-5H-pyrido(4,3-b)indole-5-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl 7-bromopyrido[4,3-b]indole-5-carboxylate (CAS 1687855-96-4) is a chemical compound with the molecular formula C16H15BrN2O2 and a molecular weight of 347.21 g/mol. IUPAC name: tert-butyl 7-bromopyrido[4,3-b]indole-5-carboxylate. InChIKey: QWPLEZQMDWYWQU-UHFFFAOYSA-N.
| Molecular formula | C16H15BrN2O2 |
|---|---|
| Molecular weight | 347.21 g/mol |
| IUPAC name | tert-butyl 7-bromopyrido[4,3-b]indole-5-carboxylate |
| InChIKey | QWPLEZQMDWYWQU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=NC=C2)C3=C1C=C(C=C3)Br |
Computed by PubChem (NCBI)