CAS 16881-71-3 appears in our catalog under these names: 4-(4-Methoxyphenyl)phenol, 96%, 4–(4–Methoxyphenyl)phenol, 4-Hydroxy-4'-methoxybiphenyl, >95.0%(GC), 4'-Methoxy-[1,1'-biphenyl]-4-ol 98%, 4'-Methoxy-[1,1'-biphenyl]-4-ol, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
4-(4-methoxyphenyl)phenol (CAS 16881-71-3) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 4-(4-methoxyphenyl)phenol. InChIKey: CORJIEYQXMZUIW-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)phenol |
| InChIKey | CORJIEYQXMZUIW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)