CAS 168971-55-9 is the registry number for 2-(Aminomethyl)-N,N-dimethylbenzene-1-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-(aminomethyl)-N,N-dimethylbenzenesulfonamide (CAS 168971-55-9) is a chemical compound with the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. IUPAC name: 2-(aminomethyl)-N,N-dimethylbenzenesulfonamide. InChIKey: WQMFADOHVUURRX-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | 2-(aminomethyl)-N,N-dimethylbenzenesulfonamide |
| InChIKey | WQMFADOHVUURRX-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=CC=C1CN |
Computed by PubChem (NCBI)