CAS 1691896-14-6 is the registry number for 2-((Methylsulfonyl)methyl)nicotinic acid, 95+%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
2-(methylsulfonylmethyl)pyridine-3-carboxylic acid (CAS 1691896-14-6) is a chemical compound with the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. IUPAC name: 2-(methylsulfonylmethyl)pyridine-3-carboxylic acid. InChIKey: UBDWYFYRPCJOLI-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4S |
|---|---|
| Molecular weight | 215.23 g/mol |
| IUPAC name | 2-(methylsulfonylmethyl)pyridine-3-carboxylic acid |
| InChIKey | UBDWYFYRPCJOLI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=C(C=CC=N1)C(=O)O |
Computed by PubChem (NCBI)