CAS 16927-50-7 is the registry number for 5-Nitro-2-(phenylamino)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-anilino-5-nitrobenzoic acid (CAS 16927-50-7) is a chemical compound with the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. IUPAC name: 2-anilino-5-nitrobenzoic acid. InChIKey: DOTLBHVBCHNOAA-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O4 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 2-anilino-5-nitrobenzoic acid |
| InChIKey | DOTLBHVBCHNOAA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=C(C=C(C=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)