Products 16931-47-8
CAS 16931-47-8 appears in our catalog under these names: 2-([Methyl(phenyl)amino]carbonyl)benzoic acid, 95%, 2-(Methyl(phenyl)carbamoyl)benzoic acid, 95+%, 2-(Methyl(phenyl)carbamoyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-[methyl(phenyl)carbamoyl]benzoic acid (CAS 16931-47-8) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: 2-[methyl(phenyl)carbamoyl]benzoic acid. InChIKey: VBCNWIPFKYOODC-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 2-[methyl(phenyl)carbamoyl]benzoic acid |
| InChIKey | VBCNWIPFKYOODC-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=CC=C1)C(=O)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)