CAS 7510-49-8 appears in our catalog under these names: 2-Benzoylamino-benzoic acid methyl ester, 95%, Methyl 2-benzamidobenzoate, 95+%, Methyl 2–benzamidobenzoate, Methyl 2-benzoylaminobenzoate, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
Methyl 2-benzamidobenzoate (CAS 7510-49-8) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: methyl 2-benzamidobenzoate. InChIKey: NOMUELNZAGGIDL-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | methyl 2-benzamidobenzoate |
| InChIKey | NOMUELNZAGGIDL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC=C1NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)