CAS 99134-77-7 appears in our catalog under these names: Phenyl 4-acetylphenylcarbamate, 95%, Phenyl N-(4-acetylphenyl)carbamate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g.
Phenyl N-(4-acetylphenyl)carbamate (CAS 99134-77-7) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: phenyl N-(4-acetylphenyl)carbamate. InChIKey: LETGZXPZNAIRNJ-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | phenyl N-(4-acetylphenyl)carbamate |
| InChIKey | LETGZXPZNAIRNJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)NC(=O)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)