CAS 10308-54-0 is the registry number for 4-(4-Hydroxyphenyl)-4-azatricyclo[5.2.1.0(2,6)]dec-8-ene-3,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(4-hydroxyphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CAS 10308-54-0) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: 4-(4-hydroxyphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione. InChIKey: XOTYSWSIKRFMRI-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 4-(4-hydroxyphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| InChIKey | XOTYSWSIKRFMRI-UHFFFAOYSA-N |
| SMILES | C1C2C=CC1C3C2C(=O)N(C3=O)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)