CAS 401828-76-0 appears in our catalog under these names: 3-(Benzoylamino)-4-methylbenzoic acid, 95%, 3-Benzamido-4-methylbenzoic acid 97%, 3-Benzamido-4-methylbenzoic acid, 97%, 97%, 3-(benzoylamino)-4-methylbenzoic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
3-benzamido-4-methylbenzoic acid (CAS 401828-76-0) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: 3-benzamido-4-methylbenzoic acid. InChIKey: CYXPYFDVSXZFNX-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 3-benzamido-4-methylbenzoic acid |
| InChIKey | CYXPYFDVSXZFNX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)