CAS 16948-40-6 appears in our catalog under these names: Boc-val-onp, 98%, Boc-Val-ONp, 98+%, Boc–Val–ONp, Boc-L-Val-ONp, N-(tert-Butoxycarbonyl)-L-valine 4-nitrophenyl ester, ≥97%, ≥97%. Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech, Chemat. Available pack sizes: 5g, 25g, 1g.
(4-nitrophenyl) (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 16948-40-6) is a chemical compound with the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. IUPAC name: (4-nitrophenyl) (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: ALJZEMRUAOJSPP-ZDUSSCGKSA-N.
| Molecular formula | C16H22N2O6 |
|---|---|
| Molecular weight | 338.36 g/mol |
| IUPAC name | (4-nitrophenyl) (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | ALJZEMRUAOJSPP-ZDUSSCGKSA-N |
| SMILES | CC(C)[C@@H](C(=O)OC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)