CAS 65710-57-8 appears in our catalog under these names: (S)–3–Benzyloxycarbonylamino–2–(Boc–amino)propionic acid, Boc-Dap (Z)-OH, Boc-Dap(Cbz)-OH 97%, Boc-Dap(Z)-OH, 98%, 98%, (S)-3-Benzyloxycarbonylamino-2-(Boc-amino)propionic acid, 99.61%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 500mg, 5g, 100g, 1000g, 250mg, 10g, 25g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)propanoic acid (CAS 65710-57-8) is a chemical compound with the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: QKMSMVGTLTVHLK-LBPRGKRZSA-N.
| Molecular formula | C16H22N2O6 |
|---|---|
| Molecular weight | 338.36 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | QKMSMVGTLTVHLK-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CNC(=O)OCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)