CAS 395639-03-9 appears in our catalog under these names: N,N-Di-boc-4-nitroaniline, 95%, N,N-DI-Boc-4-nitroaniline, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(4-nitrophenyl)carbamate (CAS 395639-03-9) is a chemical compound with the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. IUPAC name: tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(4-nitrophenyl)carbamate. InChIKey: QYACWUAPVKEIAD-UHFFFAOYSA-N.
| Molecular formula | C16H22N2O6 |
|---|---|
| Molecular weight | 338.36 g/mol |
| IUPAC name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(4-nitrophenyl)carbamate |
| InChIKey | QYACWUAPVKEIAD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=CC=C(C=C1)[N+](=O)[O-])C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)