CAS 41120-72-3 is the registry number for (S)-2-Nitrophenyl 2-((tert-butoxycarbonyl)amino)-3-methylbutanoate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-nitrophenyl) (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 41120-72-3) is a chemical compound with the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. IUPAC name: (2-nitrophenyl) (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: VLDCNDJHWYOCCG-ZDUSSCGKSA-N.
| Molecular formula | C16H22N2O6 |
|---|---|
| Molecular weight | 338.36 g/mol |
| IUPAC name | (2-nitrophenyl) (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | VLDCNDJHWYOCCG-ZDUSSCGKSA-N |
| SMILES | CC(C)[C@@H](C(=O)OC1=CC=CC=C1[N+](=O)[O-])NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)