Products 27482-74-2

CAS 27482-74-2 is the registry number for Z-Thr-gly-oet, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 2-[[(2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetate (CAS 27482-74-2) is a chemical compound with the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. IUPAC name: ethyl 2-[[(2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetate. InChIKey: HJLLTKBIYMYCMV-RISCZKNCSA-N.

Identity
Molecular formulaC16H22N2O6
Molecular weight338.36 g/mol
IUPAC nameethyl 2-[[(2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetate
InChIKeyHJLLTKBIYMYCMV-RISCZKNCSA-N
SMILESCCOC(=O)CNC(=O)[C@H]([C@@H](C)O)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)