Products 1696207-04-1
CAS 1696207-04-1 is the registry number for 3,3-Dimethyl-1-(2-methyl-5-nitrophenyl)urea. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,1-dimethyl-3-(2-methyl-5-nitrophenyl)urea (CAS 1696207-04-1) is a chemical compound with the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. IUPAC name: 1,1-dimethyl-3-(2-methyl-5-nitrophenyl)urea. InChIKey: JEBAJPLOVQYDOG-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O3 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 1,1-dimethyl-3-(2-methyl-5-nitrophenyl)urea |
| InChIKey | JEBAJPLOVQYDOG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])NC(=O)N(C)C |
Computed by PubChem (NCBI)