CAS 169677-20-7 appears in our catalog under these names: 4-tert-Amylbenzenesulfonyl chloride, 95%, 4-tert-Amylbenzenesulfonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 10g.
4-(2-methylbutan-2-yl)benzenesulfonyl chloride (CAS 169677-20-7) is a chemical compound with the molecular formula C11H15ClO2S and a molecular weight of 246.75 g/mol. IUPAC name: 4-(2-methylbutan-2-yl)benzenesulfonyl chloride. InChIKey: WLBQFZZPRWQTGR-UHFFFAOYSA-N.
| Molecular formula | C11H15ClO2S |
|---|---|
| Molecular weight | 246.75 g/mol |
| IUPAC name | 4-(2-methylbutan-2-yl)benzenesulfonyl chloride |
| InChIKey | WLBQFZZPRWQTGR-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)