Products 73948-18-2
CAS 73948-18-2 appears in our catalog under these names: 4-Pentylbenzene-1-sulfonyl chloride, 98%, 4-n-Pentylbenzenesulfonyl chloride, 97% , 4-n-Amylbenzenesulphonyl choride, 4-Pentylbenzene-1-sulfonyl chloride 97%, 4-Pentylbenzene-1-sulfonyl chloride, 99%, 99%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 25g, 1g, 10g, 2.5g, 50g, 250mg.
4-pentylbenzenesulfonyl chloride (CAS 73948-18-2) is a chemical compound with the molecular formula C11H15ClO2S and a molecular weight of 246.75 g/mol. IUPAC name: 4-pentylbenzenesulfonyl chloride. InChIKey: XDWXZRVWJHEWMT-UHFFFAOYSA-N.
| Molecular formula | C11H15ClO2S |
|---|---|
| Molecular weight | 246.75 g/mol |
| IUPAC name | 4-pentylbenzenesulfonyl chloride |
| InChIKey | XDWXZRVWJHEWMT-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-t-Amylbenzenesulphonyl chloride, 4-pentylbenzenesulfonyl Chloride, 4-n-Pentylbenzenesulfonyl chloride, 4-(n-pentyl)benzenesulfonyl chloride, 4-n-amylbenzenesulfonyl chloride, 4-(Pent-1-yl)benzenesulphonyl chloride, 4-n-Amylbenzenesulphonyl choride, 4-n-AmylbenZenesulphonyl chloride, 4-n-pentylbenzenesulphonyl chloride, Benzenesulfonyl chloride, 4-pentyl- (9CI)