Products 63452-62-0

CAS 63452-62-0 is the registry number for 5-tert-Butyl-2-methyl-benzenesulfonyl chloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

5-tert-butyl-2-methylbenzenesulfonyl chloride (CAS 63452-62-0) is a chemical compound with the molecular formula C11H15ClO2S and a molecular weight of 246.75 g/mol. IUPAC name: 5-tert-butyl-2-methylbenzenesulfonyl chloride. InChIKey: OVTOPAMDBHJZNS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15ClO2S
Molecular weight246.75 g/mol
IUPAC name5-tert-butyl-2-methylbenzenesulfonyl chloride
InChIKeyOVTOPAMDBHJZNS-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C(C)(C)C)S(=O)(=O)Cl

Computed by PubChem (NCBI)