CAS 519056-61-2 appears in our catalog under these names: (4-tert-butylphenyl)methanesulfonyl chloride, 95%, (4-tert-Butylphenyl)methanesulfonyl chloride, [4-(tert-Butyl)phenyl]methanesulfonyl chloride, Tech. . Offered by: Combi-blocks, Biosynth, Thermo Scientific. Available pack sizes: 5g, 1g, 2,5g, 250MG.
(4-tert-butylphenyl)methanesulfonyl chloride (CAS 519056-61-2) is a chemical compound with the molecular formula C11H15ClO2S and a molecular weight of 246.75 g/mol. IUPAC name: (4-tert-butylphenyl)methanesulfonyl chloride. InChIKey: NEJDUPGGBSPJLG-UHFFFAOYSA-N.
| Molecular formula | C11H15ClO2S |
|---|---|
| Molecular weight | 246.75 g/mol |
| IUPAC name | (4-tert-butylphenyl)methanesulfonyl chloride |
| InChIKey | NEJDUPGGBSPJLG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)