CAS 52499-94-2 appears in our catalog under these names: Pentamethylbenzenesulfonyl chloride, 97%, Pentamethylbenzenesulfonyl chloride, 2,3,4,5,6-Pentamethylbenzene-1-sulfonyl chloride 95%, 2,3,4,5,6-Pentamethylbenzene-1-sulfonyl chloride, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 25g, 1g, 100g, 5g, 10g, 50g.
2,3,4,5,6-pentamethylbenzenesulfonyl chloride (CAS 52499-94-2) is a chemical compound with the molecular formula C11H15ClO2S and a molecular weight of 246.75 g/mol. IUPAC name: 2,3,4,5,6-pentamethylbenzenesulfonyl chloride. InChIKey: VDBXRBKVRRJRRW-UHFFFAOYSA-N.
| Molecular formula | C11H15ClO2S |
|---|---|
| Molecular weight | 246.75 g/mol |
| IUPAC name | 2,3,4,5,6-pentamethylbenzenesulfonyl chloride |
| InChIKey | VDBXRBKVRRJRRW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)C)S(=O)(=O)Cl)C)C |
Computed by PubChem (NCBI)