Products 1698027-53-0
CAS 1698027-53-0 is the registry number for 6-Bromo-7-chloro-2,3-dihydroindole-2,3-dione, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-7-chloro-1H-indole-2,3-dione (CAS 1698027-53-0) is a chemical compound with the molecular formula C8H3BrClNO2 and a molecular weight of 260.47 g/mol. IUPAC name: 6-bromo-7-chloro-1H-indole-2,3-dione. InChIKey: AGADFKZYZROJKG-UHFFFAOYSA-N.
| Molecular formula | C8H3BrClNO2 |
|---|---|
| Molecular weight | 260.47 g/mol |
| IUPAC name | 6-bromo-7-chloro-1H-indole-2,3-dione |
| InChIKey | AGADFKZYZROJKG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=O)C(=O)N2)Cl)Br |
Computed by PubChem (NCBI)