Products 1805135-63-0

CAS 1805135-63-0 is the registry number for 6-Bromo-2-chloro-3-cyanobenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-bromo-2-chloro-3-cyanobenzoic acid (CAS 1805135-63-0) is a chemical compound with the molecular formula C8H3BrClNO2 and a molecular weight of 260.47 g/mol. IUPAC name: 6-bromo-2-chloro-3-cyanobenzoic acid. InChIKey: GANUFEDLLRWJKT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3BrClNO2
Molecular weight260.47 g/mol
IUPAC name6-bromo-2-chloro-3-cyanobenzoic acid
InChIKeyGANUFEDLLRWJKT-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1C#N)Cl)C(=O)O)Br

Computed by PubChem (NCBI)