CAS 312590-29-7 appears in our catalog under these names: 7-Bromo-5-chloroindoline-2,3-dione, 7-Bromo-5-chloroindoline-2,3-dione, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 0,5g, 250mg, 1g.
7-bromo-5-chloro-1H-indole-2,3-dione (CAS 312590-29-7) is a chemical compound with the molecular formula C8H3BrClNO2 and a molecular weight of 260.47 g/mol. IUPAC name: 7-bromo-5-chloro-1H-indole-2,3-dione. InChIKey: OXVYPUHFVFBLBO-UHFFFAOYSA-N.
| Molecular formula | C8H3BrClNO2 |
|---|---|
| Molecular weight | 260.47 g/mol |
| IUPAC name | 7-bromo-5-chloro-1H-indole-2,3-dione |
| InChIKey | OXVYPUHFVFBLBO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C(=O)N2)Br)Cl |
Computed by PubChem (NCBI)