CAS 613656-97-6 appears in our catalog under these names: 5-Bromo-7-chloro-1h-indole-2,3-dione, 95%, 5-Bromo-7-chloroindoline-2,3-dione, 5-bromo-7-chloro-1H-indole-2,3-dione, 95+%, 95+%, 5-Bromo-7-chloroindoline-2,3-dione, 95+%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 2,5g, 100mg, 250mg, 5g.
5-bromo-7-chloro-1H-indole-2,3-dione (CAS 613656-97-6) is a chemical compound with the molecular formula C8H3BrClNO2 and a molecular weight of 260.47 g/mol. IUPAC name: 5-bromo-7-chloro-1H-indole-2,3-dione. InChIKey: UTTYWJPFQPXSJI-UHFFFAOYSA-N.
| Molecular formula | C8H3BrClNO2 |
|---|---|
| Molecular weight | 260.47 g/mol |
| IUPAC name | 5-bromo-7-chloro-1H-indole-2,3-dione |
| InChIKey | UTTYWJPFQPXSJI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C(=O)N2)Cl)Br |
Computed by PubChem (NCBI)