CAS 3018-39-1 appears in our catalog under these names: 5-Bromo-4-chloro-2,3-dihydro-1H-indole-2,3-dione, 95%, 5-Bromo-4-chloro-2,3-dihydro-1H-indole-2,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-bromo-4-chloro-1H-indole-2,3-dione (CAS 3018-39-1) is a chemical compound with the molecular formula C8H3BrClNO2 and a molecular weight of 260.47 g/mol. IUPAC name: 5-bromo-4-chloro-1H-indole-2,3-dione. InChIKey: SQYPIQRCTFADJT-UHFFFAOYSA-N.
| Molecular formula | C8H3BrClNO2 |
|---|---|
| Molecular weight | 260.47 g/mol |
| IUPAC name | 5-bromo-4-chloro-1H-indole-2,3-dione |
| InChIKey | SQYPIQRCTFADJT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NC(=O)C2=O)Cl)Br |
Computed by PubChem (NCBI)