Products 1698970-59-0
CAS 1698970-59-0 appears in our catalog under these names: 2-Cyclopropyl-4-(difluoromethyl)-1,3-oxazole-5-carboxylic acid, 95%, 2-Cyclopropyl-4-(difluoromethyl)-1,3-oxazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-cyclopropyl-4-(difluoromethyl)-1,3-oxazole-5-carboxylic acid (CAS 1698970-59-0) is a chemical compound with the molecular formula C8H7F2NO3 and a molecular weight of 203.14 g/mol. IUPAC name: 2-cyclopropyl-4-(difluoromethyl)-1,3-oxazole-5-carboxylic acid. InChIKey: LAJCLOGFJXURPG-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO3 |
|---|---|
| Molecular weight | 203.14 g/mol |
| IUPAC name | 2-cyclopropyl-4-(difluoromethyl)-1,3-oxazole-5-carboxylic acid |
| InChIKey | LAJCLOGFJXURPG-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC(=C(O2)C(=O)O)C(F)F |
Computed by PubChem (NCBI)