CAS 1699688-02-2 is the registry number for 2-Amino-2-(2,5-dichlorophenyl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-2-(2,5-dichlorophenyl)acetamide (CAS 1699688-02-2) is a chemical compound with the molecular formula C8H8Cl2N2O and a molecular weight of 219.06 g/mol. IUPAC name: 2-amino-2-(2,5-dichlorophenyl)acetamide. InChIKey: TULYKSUSTMHRKE-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 2-amino-2-(2,5-dichlorophenyl)acetamide |
| InChIKey | TULYKSUSTMHRKE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(C(=O)N)N)Cl |
Computed by PubChem (NCBI)