CAS 1700637-11-1 is the registry number for 6-Bromo-2,8-dimethyl-4H-benzo[d][1,3]oxazin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2,8-dimethyl-3,1-benzoxazin-4-one (CAS 1700637-11-1) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 6-bromo-2,8-dimethyl-3,1-benzoxazin-4-one. InChIKey: WICJOMUANXBTIU-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 6-bromo-2,8-dimethyl-3,1-benzoxazin-4-one |
| InChIKey | WICJOMUANXBTIU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1N=C(OC2=O)C)Br |
Computed by PubChem (NCBI)