Products 170230-01-0
CAS 170230-01-0 appears in our catalog under these names: 4-Bromo-n-methoxy-n,3-dimethylbenzamide, 95%, 4-Bromo-N-methoxy-N,3-dimethylbenzamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 100mg.
4-bromo-N-methoxy-N,3-dimethylbenzamide (CAS 170230-01-0) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: 4-bromo-N-methoxy-N,3-dimethylbenzamide. InChIKey: BPLLHXSVCZPIST-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | 4-bromo-N-methoxy-N,3-dimethylbenzamide |
| InChIKey | BPLLHXSVCZPIST-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)N(C)OC)Br |
Computed by PubChem (NCBI)